cas: 960000-93-5 — see every product listed under this CAS number, including other names
1-Bromo-4-chloro-5-fluoro-2-nitrobenzene, 97%, 97% (CAS 960000-93-5) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 500g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116W1O-50g |
| cas | 960000-93-5 |
| size | 50g |
| availability | 765g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 717.20 Pln | |
| Chemat | 100g | 1163.60 Pln | |
| Chemat | 250g | 2541.20 Pln | |
| Chemat | 500g | 4612.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 438.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-chloro-5-fluoro-2-nitrobenzene (CAS 960000-93-5) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-4-chloro-5-fluoro-2-nitrobenzene. InChIKey: IBPDXAYILRNZRH-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-4-chloro-5-fluoro-2-nitrobenzene |
| InChIKey | IBPDXAYILRNZRH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)