cas: 1187385-70-1 — see every product listed under this CAS number, including other names
1-Bromo-5-fluoro-4-iodo-2-nitrobenzene, 98% (CAS 1187385-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216076-250MG |
| cas | 1187385-70-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 768.50 Pln | |
| Fluorochem | 10g | 1434.93 Pln | |
| Fluorochem | 25g | 2856.30 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-5-fluoro-4-iodo-2-nitrobenzene (CAS 1187385-70-1) is a chemical compound with the molecular formula C6H2BrFINO2 and a molecular weight of 345.89 g/mol. IUPAC name: 1-bromo-5-fluoro-4-iodo-2-nitrobenzene. InChIKey: CCIQHIQHQUTIAC-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFINO2 |
|---|---|
| Molecular weight | 345.89 g/mol |
| IUPAC name | 1-bromo-5-fluoro-4-iodo-2-nitrobenzene |
| InChIKey | CCIQHIQHQUTIAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)