cas: 16807-11-7 — see every product listed under this CAS number, including other names
1-Bromo-9H-carbazole 97% (CAS 16807-11-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A157915-100mg |
| cas | 16807-11-7 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Ambeed | 100g | 1749.88 Pln | |
| Ambeed | 500g | 8469.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A157915 |
1-bromo-9H-carbazole (CAS 16807-11-7) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 1-bromo-9H-carbazole. InChIKey: VCDOOGZTWDOHEB-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 1-bromo-9H-carbazole |
| InChIKey | VCDOOGZTWDOHEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Br |
Computed by PubChem (NCBI)