1-Bromo-9H-carbazole, 99%, 99%
cas: 16807-11-7 — see every product listed under this CAS number, including other names
1-Bromo-9H-carbazole, 99%, 99% (CAS 16807-11-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112XRW-100mg |
| cas | 16807-11-7 |
| size | 100mg |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 362.00 Pln | |
| Chemat | 50g | 635.60 Pln | |
| Chemat | 100g | 1178.00 Pln | |
| Chemat | 250g | 2834.00 Pln | |
| Chemat | 1kg | 6818.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-bromo-9H-carbazole (CAS 16807-11-7) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 1-bromo-9H-carbazole. InChIKey: VCDOOGZTWDOHEB-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 1-bromo-9H-carbazole |
| InChIKey | VCDOOGZTWDOHEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Br |
Computed by PubChem (NCBI)