CAS 401469-73-6 appears in our catalog under these names: 2-(4-Bromonaphthalen-2-yl)acetonitrile, 95%, 2–(4–Bromonaphthalen–2–yl)acetonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-(4-bromonaphthalen-2-yl)acetonitrile (CAS 401469-73-6) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 2-(4-bromonaphthalen-2-yl)acetonitrile. InChIKey: SUMAJOULTIGOOM-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 2-(4-bromonaphthalen-2-yl)acetonitrile |
| InChIKey | SUMAJOULTIGOOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2Br)CC#N |
Computed by PubChem (NCBI)