cas: 50548-45-3 — see every product listed under this CAS number, including other names
1-Bromodibenzo[b,d]furan 97% (CAS 50548-45-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212767-500g |
| cas | 50548-45-3 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 14209.88 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 954.44 Pln | |
| Ambeed | 100g | 3607.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A212767 |
1-bromodibenzofuran (CAS 50548-45-3) is a chemical compound with the molecular formula C12H7BrO and a molecular weight of 247.09 g/mol. IUPAC name: 1-bromodibenzofuran. InChIKey: WUYYVOWEBMOELQ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 1-bromodibenzofuran |
| InChIKey | WUYYVOWEBMOELQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC=C3Br |
Computed by PubChem (NCBI)