CAS 103456-35-5 is the registry number for BROMODIBENZOFURAN, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
1-bromodibenzofuran (CAS 103456-35-5) is a chemical compound with the molecular formula C12H7BrO and a molecular weight of 247.09 g/mol. IUPAC name: 1-bromodibenzofuran. InChIKey: WUYYVOWEBMOELQ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 1-bromodibenzofuran |
| InChIKey | WUYYVOWEBMOELQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC=C3Br |
Computed by PubChem (NCBI)