CAS 878132-20-8 appears in our catalog under these names: 1–Butyl–3–methyl–1H–imidazol–3–ium (S)–2–hydroxypropanoate, 1-Butyl-3-methyl-1H-imidazol-3-ium 2-hydroxypropanoate, 1-Butyl-3-methyl-1H-imidazol-3-ium (S)-2-hydroxypropanoate, 98%+(HPLC),RG. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
1-butyl-3-methylimidazol-3-ium;(2S)-2-hydroxypropanoate (CAS 878132-20-8) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium;(2S)-2-hydroxypropanoate. InChIKey: CYFFKUDZLZREEX-WNQIDUERSA-M.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium;(2S)-2-hydroxypropanoate |
| InChIKey | CYFFKUDZLZREEX-WNQIDUERSA-M |
| SMILES | CCCCN1C=C[N+](=C1)C.C[C@@H](C(=O)[O-])O |
Computed by PubChem (NCBI)