CAS 848488-91-5 appears in our catalog under these names: (R)-1-N-Boc-pipecolamide, 95%, (R)–1–N–Boc–Pipecolamide, (R)-tert-Butyl 2-carbamoylpiperidine-1-carboxylate 98%, (R)-tert-Butyl 2-carbamoylpiperidine-1-carboxylate, 98%, 98%, (R)-1-N-Boc-Pipecolamide, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Tert-butyl (2R)-2-carbamoylpiperidine-1-carboxylate (CAS 848488-91-5) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (2R)-2-carbamoylpiperidine-1-carboxylate. InChIKey: KIFYKONQFFJILQ-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-carbamoylpiperidine-1-carboxylate |
| InChIKey | KIFYKONQFFJILQ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)N |
Computed by PubChem (NCBI)