1-Butyl-3-methylpyridin-1-ium hexafluorophosphate(V), 99%
cas: 845835-03-2 — see every product listed under this CAS number, including other names
1-Butyl-3-methylpyridin-1-ium hexafluorophosphate(V), 99% (CAS 845835-03-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A115869-5g |
| cas | 845835-03-2 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 414.88 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 482.00 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 442.09 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
1-butyl-3-methylpyridin-1-ium hexafluorophosphate (CAS 845835-03-2) is a chemical compound with the molecular formula C10H16F6NP and a molecular weight of 295.20 g/mol. IUPAC name: 1-butyl-3-methylpyridin-1-ium hexafluorophosphate. InChIKey: XUZKQHMUEBPODI-UHFFFAOYSA-N.
| Molecular formula | C10H16F6NP |
|---|---|
| Molecular weight | 295.20 g/mol |
| IUPAC name | 1-butyl-3-methylpyridin-1-ium hexafluorophosphate |
| InChIKey | XUZKQHMUEBPODI-UHFFFAOYSA-N |
| SMILES | CCCC[N+]1=CC=CC(=C1)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1-Butyl-3-methylpyridinium hexafluorophosphate, 1-Butyl-3-methylpyridin-1-ium hexafluorophosphate(V), 1-butyl-3-methylpyridin-1-ium;hexafluorophosphate, N-butyl-3-metylpyridinium hexafluorophosphate, 1-n-Butyl-3-methylpyridinium hexafluorophosphate, B3MePyPF6, Tox21_202682, 3-methyl-N-butylpyridinium hexafluorophosphate, 1-Butyl-3-methyl-1-pyridinium Hexafluorophosphate, 1-butyl-3-methyl-pyridin-1-ium;hexafluorophosphate
