CAS 401788-99-6 appears in our catalog under these names: 1-n-Butyl-4-methylpyridinium hexafluorophosphate, 99% , 1–Butyl–4–methylpyridinium hexafluorophosphate, 1-Butyl-4-methylpyridinium Hexafluorophosphate, >97.0%(T), 1-Butyl-4-methylpyridinium Hexafluorophosphate 97%, 1-Butyl-4-Methylpyridinium Hexafluorophosphate, 97%, 97%. Offered by: Thermo Scientific (Alfa Aesar), GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 50g, 25g, 100g, 500g, 10g.
1-butyl-4-methylpyridin-1-ium hexafluorophosphate (CAS 401788-99-6) is a chemical compound with the molecular formula C10H16F6NP and a molecular weight of 295.20 g/mol. IUPAC name: 1-butyl-4-methylpyridin-1-ium hexafluorophosphate. InChIKey: XBSZSSGZQFAUPF-UHFFFAOYSA-N.
| Molecular formula | C10H16F6NP |
|---|---|
| Molecular weight | 295.20 g/mol |
| IUPAC name | 1-butyl-4-methylpyridin-1-ium hexafluorophosphate |
| InChIKey | XBSZSSGZQFAUPF-UHFFFAOYSA-N |
| SMILES | CCCC[N+]1=CC=C(C=C1)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)