CAS 845835-03-2 appears in our catalog under these names: 1-N-Butyl-3-methylpyridinium hexafluorophosphate, 98%, 1–Butyl–3–methylpyridin–1–ium hexafluorophosphate(V), 1-Butyl-3-methylpyridin-1-ium hexafluorophosphate(V) 99%, 1-Butyl-3-methylpyridin-1-ium hexafluorophosphate(V), 99%, 99%, 1-BUTYL-3-METHYLPYRIDINIUM HEXAFLUOROPHOSPHATE, 99%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g.
1-butyl-3-methylpyridin-1-ium hexafluorophosphate (CAS 845835-03-2) is a chemical compound with the molecular formula C10H16F6NP and a molecular weight of 295.20 g/mol. IUPAC name: 1-butyl-3-methylpyridin-1-ium hexafluorophosphate. InChIKey: XUZKQHMUEBPODI-UHFFFAOYSA-N.
| Molecular formula | C10H16F6NP |
|---|---|
| Molecular weight | 295.20 g/mol |
| IUPAC name | 1-butyl-3-methylpyridin-1-ium hexafluorophosphate |
| InChIKey | XUZKQHMUEBPODI-UHFFFAOYSA-N |
| SMILES | CCCC[N+]1=CC=CC(=C1)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)