1-Butyl-4-methylpyridinium Hexafluorophosphate, 97%
cas: 401788-99-6 — see every product listed under this CAS number, including other names
1-Butyl-4-methylpyridinium Hexafluorophosphate, 97% (CAS 401788-99-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 10g, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A988776-5g |
| cas | 401788-99-6 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 442.69 Pln | |
| Ambeed | 500g | 1816.62 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 270.80 Pln | |
| Chemat | 500g | 1132.80 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 169.96 Pln | |
| BLDpharm | 100g | 447.64 Pln | |
| BLDpharm | 500g | 1930.46 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 424.87 Pln | |
| Fluorochem | 500g | 1809.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-butyl-4-methylpyridin-1-ium hexafluorophosphate (CAS 401788-99-6) is a chemical compound with the molecular formula C10H16F6NP and a molecular weight of 295.20 g/mol. IUPAC name: 1-butyl-4-methylpyridin-1-ium hexafluorophosphate. InChIKey: XBSZSSGZQFAUPF-UHFFFAOYSA-N.
| Molecular formula | C10H16F6NP |
|---|---|
| Molecular weight | 295.20 g/mol |
| IUPAC name | 1-butyl-4-methylpyridin-1-ium hexafluorophosphate |
| InChIKey | XBSZSSGZQFAUPF-UHFFFAOYSA-N |
| SMILES | CCCC[N+]1=CC=C(C=C1)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1-Butyl-4-methylpyridinium hexafluorophosphate, n-butyl-4-methylpyridinium hexafluorophosphate, 1-butyl-4-methylpyridin-1-ium;hexafluorophosphate, Tox21_202687, 1-n-Butyl-4-picolinium hexafluorophosphate, 1-butyl-4-methyl-pyridin-1-ium;hexafluorophosphate, hexafluo, N-butyl-4-metylpyridinium hexafluorophosphate, XBSZSSGZQFAUPF-UHFFFAOYSA-N, 1-Butyl-4-methylpyridin-1-ium hexafluorophosphate(V)