1-Chloro-2,4-dimethyl-6-nitrobenzene, 95%
cas: 16618-56-7 — see every product listed under this CAS number, including other names
1-Chloro-2,4-dimethyl-6-nitrobenzene, 95% (CAS 16618-56-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A681154-100mg |
| cas | 16618-56-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2167.06 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1624.40 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2324.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-1,5-dimethyl-3-nitrobenzene (CAS 16618-56-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-1,5-dimethyl-3-nitrobenzene. InChIKey: HIMVDAUFQRCQFX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-1,5-dimethyl-3-nitrobenzene |
| InChIKey | HIMVDAUFQRCQFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C |
Computed by PubChem (NCBI)