Products 155184-81-9
CAS 155184-81-9 appears in our catalog under these names: 2-Amino-4-chloro-5-methyl-benzoic acid, 97%, 2-Amino-4-chloro-5-methylbenzoic acid, 98%, 2-Amino-4-chloro-5-methylbenzoic acid 97%, 2-Amino-4-chloro-5-methylbenzoic acid, 97%, 97%, 2-AMINO-4-CHLORO-5-METHYLBENZOIC ACID. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
2-amino-4-chloro-5-methylbenzoic acid (CAS 155184-81-9) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-amino-4-chloro-5-methylbenzoic acid. InChIKey: FDCMZVNLUFYRAI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-amino-4-chloro-5-methylbenzoic acid |
| InChIKey | FDCMZVNLUFYRAI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)N)C(=O)O |
Computed by PubChem (NCBI)