cas: 1009-36-5 — see every product listed under this CAS number, including other names
1-Chloro-2-methoxy-4-nitrobenzene, 97%, 97% (CAS 1009-36-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11145R-5g |
| cas | 1009-36-5 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 323.60 Pln | |
| Chemat | 500g | 1440.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2-methoxy-4-nitrobenzene (CAS 1009-36-5) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 1-chloro-2-methoxy-4-nitrobenzene. InChIKey: JXIJUAWSDBACEB-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 1-chloro-2-methoxy-4-nitrobenzene |
| InChIKey | JXIJUAWSDBACEB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)