cas: 1009-36-5 — see every product listed under this CAS number, including other names
2-Chloro-5-nitroanisole, 97% (CAS 1009-36-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F003636-1G |
| cas | 1009-36-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 346.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
1-chloro-2-methoxy-4-nitrobenzene (CAS 1009-36-5) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 1-chloro-2-methoxy-4-nitrobenzene. InChIKey: JXIJUAWSDBACEB-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 1-chloro-2-methoxy-4-nitrobenzene |
| InChIKey | JXIJUAWSDBACEB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)