CAS 1071017-49-6 appears in our catalog under these names: 1-Chloro-3-(pyridin-4-yl)-2,6-naphthyridine, 97%, 97%, 1-Chloro-3-(pyridin-4-yl)-2,6-naphthyridine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
1-chloro-3-pyridin-4-yl-2,6-naphthyridine (CAS 1071017-49-6) is a chemical compound with the molecular formula C13H8ClN3 and a molecular weight of 241.67 g/mol. IUPAC name: 1-chloro-3-pyridin-4-yl-2,6-naphthyridine. InChIKey: JALZVPARZAJMOE-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 1-chloro-3-pyridin-4-yl-2,6-naphthyridine |
| InChIKey | JALZVPARZAJMOE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=C3C=CN=CC3=C2)Cl |
Computed by PubChem (NCBI)