CAS 6484-27-1 appears in our catalog under these names: 4–Chloro–2–(4–pyridinyl)quinazoline, 4-Chloro-2-(pyridin-4-yl)quinazoline. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
4-chloro-2-pyridin-4-ylquinazoline (CAS 6484-27-1) is a chemical compound with the molecular formula C13H8ClN3 and a molecular weight of 241.67 g/mol. IUPAC name: 4-chloro-2-pyridin-4-ylquinazoline. InChIKey: RWUSMOWAZASBJI-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 4-chloro-2-pyridin-4-ylquinazoline |
| InChIKey | RWUSMOWAZASBJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CC=NC=C3)Cl |
Computed by PubChem (NCBI)