CAS 1211593-56-4 appears in our catalog under these names: 1-Chloro-3-(pyridin-4-yl)-2,7-naphthyridine, 1-Chloro-3-(pyridin-4-yl)-2,7-naphthyridine, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-chloro-3-pyridin-4-yl-2,7-naphthyridine (CAS 1211593-56-4) is a chemical compound with the molecular formula C13H8ClN3 and a molecular weight of 241.67 g/mol. IUPAC name: 1-chloro-3-pyridin-4-yl-2,7-naphthyridine. InChIKey: WZYSATHRBJEXPH-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 1-chloro-3-pyridin-4-yl-2,7-naphthyridine |
| InChIKey | WZYSATHRBJEXPH-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC(=C3C=NC=CC3=C2)Cl |
Computed by PubChem (NCBI)