1-Chloro-4-iodoisoquinoline, 95+%
cas: 927801-77-2 — see every product listed under this CAS number, including other names
1-Chloro-4-iodoisoquinoline, 95+% (CAS 927801-77-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A414016-250mg |
| cas | 927801-77-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1165.81 Pln | |
| Ambeed | 1g | 2612.06 Pln | |
| Ambeed | 5g | 7740.69 Pln | |
| BLDpharm | 100mg | 664.24 Pln | |
| BLDpharm | 250mg | 1252.92 Pln | |
| BLDpharm | 1g | 2807.92 Pln | |
| BLDpharm | 5g | 8344.86 Pln | |
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 1158.80 Pln | |
| Chemat | 1g | 3016.40 Pln | |
| Chemat | 5g | 8944.40 Pln | |
| Fluorochem | 100mg | 1148.57 Pln | |
| Fluorochem | 250mg | 2143.01 Pln | |
| Fluorochem | 1g | 5589.72 Pln | |
| Fluorochem | 5g | 16330.73 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1-chloro-4-iodoisoquinoline (CAS 927801-77-2) is a chemical compound with the molecular formula C9H5ClIN and a molecular weight of 289.50 g/mol. IUPAC name: 1-chloro-4-iodoisoquinoline. InChIKey: PZMMTXHPJQTRSP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClIN |
|---|---|
| Molecular weight | 289.50 g/mol |
| IUPAC name | 1-chloro-4-iodoisoquinoline |
| InChIKey | PZMMTXHPJQTRSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)I |
Computed by PubChem (NCBI)