CAS 847727-21-3 appears in our catalog under these names: 8–Chloro–3–iodoquinoline, 8-Chloro-3-iodoquinoline, 8-Chloro-3-iodoquinoline, 97%, Quinoline, 8-chloro-3-iodo-, 97%, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 500mg, 2.5g, 10g, 100mg.
8-chloro-3-iodoquinoline (CAS 847727-21-3) is a chemical compound with the molecular formula C9H5ClIN and a molecular weight of 289.50 g/mol. IUPAC name: 8-chloro-3-iodoquinoline. InChIKey: CLABEFPWOLGBAP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClIN |
|---|---|
| Molecular weight | 289.50 g/mol |
| IUPAC name | 8-chloro-3-iodoquinoline |
| InChIKey | CLABEFPWOLGBAP-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)Cl)I |
Computed by PubChem (NCBI)