CAS 859958-85-3 is the registry number for 8-Chloro-5-iodoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-5-iodoquinoline (CAS 859958-85-3) is a chemical compound with the molecular formula C9H5ClIN and a molecular weight of 289.50 g/mol. IUPAC name: 8-chloro-5-iodoquinoline. InChIKey: DKQYBULAMKYLQE-UHFFFAOYSA-N.
| Molecular formula | C9H5ClIN |
|---|---|
| Molecular weight | 289.50 g/mol |
| IUPAC name | 8-chloro-5-iodoquinoline |
| InChIKey | DKQYBULAMKYLQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Cl)I |
Computed by PubChem (NCBI)