cas: 2096334-27-7 — see every product listed under this CAS number, including other names
1-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 97% (CAS 2096334-27-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A473523-250mg |
| cas | 2096334-27-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A473523 |
1-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2096334-27-7) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: 1-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: IDSSRSBZJMSRGW-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | 1-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | IDSSRSBZJMSRGW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CCCC3 |
Computed by PubChem (NCBI)