CAS 2096334-27-7 appears in our catalog under these names: 1-Cyclopentyl-1H-pyrazole-5-boronic acid, pinacol ester, 98%, 1-Cyclopentyl-1H-pyrazole-5-boronic acid, pinacol ester, 1-Cyclopentyl-1H-pyrazole-5-boronic acid, pinacol ester, 97%, 97%, 1-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 2,5g, 250mg.
1-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2096334-27-7) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: 1-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: IDSSRSBZJMSRGW-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | 1-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | IDSSRSBZJMSRGW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CCCC3 |
Computed by PubChem (NCBI)