CAS 1353041-35-6 is the registry number for N-isopropyl-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1353041-35-6) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: N-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: ZPLDFKURQLURSC-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | N-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | ZPLDFKURQLURSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)NC(C)C |
Computed by PubChem (NCBI)