cas: 1151802-22-0 — see every product listed under this CAS number, including other names
1-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97% (CAS 1151802-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211540-250MG |
| cas | 1151802-22-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 706.02 Pln | |
| Fluorochem | 25g | 1684.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1151802-22-0) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 1-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: NLWYVKHISUTBMY-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 1-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | NLWYVKHISUTBMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CC3 |
Computed by PubChem (NCBI)