CAS 2123477-78-9 appears in our catalog under these names: 1-Cyclopropylpyrazole-5-boronic acid pinacol ester, 95%, 1-Cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%, (1-cyclopropyl-1h-pyrazol-5-yl)boronic acid pinacol ester, 1-Cyclopropylpyrazole-5-boronic Acid Pinacol Ester, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 5g, 10g.
1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2123477-78-9) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: KCDXIJGKLSHKBL-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 1-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | KCDXIJGKLSHKBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CC3 |
Computed by PubChem (NCBI)