CAS 1171044-16-8 appears in our catalog under these names: 3-[(4-methylpiperazin-1-yl)methyl]phenylboronic acid, 95%, (3-((4-Methylpiperazin-1-yl)methyl)phenyl)boronic acid, 95-<97%, (3-((4-Methylpiperazin-1-yl)methyl)phenyl)boronic acid, ≥97-<99%, {3-((4-Methylpiperazin-1-yl)methyl)phenyl}boronic acid, B-[3-[(4-Methyl-1-piperazinyl)methyl]phenyl]boronic acid, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g, 25g, 50g, 0,5g.
[3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid (CAS 1171044-16-8) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: [3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid. InChIKey: NGSHSQFNJGUKCF-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | [3-[(4-methylpiperazin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | NGSHSQFNJGUKCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)