1-Deoxynojirimycin HCl 96%
cas: 73285-50-4 — see every product listed under this CAS number, including other names
1-Deoxynojirimycin HCl 96% (CAS 73285-50-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198597-25mg |
| cas | 73285-50-4 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 325.88 Pln | |
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 2311.69 Pln | |
| Ambeed | 5g | 7918.69 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A198597 |
(2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 73285-50-4) is a chemical compound with the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. IUPAC name: (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: ZJIHMALTJRDNQI-VFQQELCFSA-N.
| Molecular formula | C6H14ClNO4 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | ZJIHMALTJRDNQI-VFQQELCFSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Deoxynojirimycin hydrochloride, Duvoglustat hydrochloride, Duvoglustat HCl, Moranoline hydrochloride, 1 Deoxynojirimycin Hydrochloride, Deoxynojirimycin hydrochloride, (2R,3R,4R,5S)-2-(Hydroxymethyl)piperidine-3,4,5-triol hydrochloride, 1-Deoxy-L-altronojirimycin Hydrochloride, Moranoline HCl, Duvoglustat hydrochloride [USAN]