cas: 73285-50-4 — see every product listed under this CAS number, including other names
1-Deoxynojirimycin hydrochloride (CAS 73285-50-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 0,5g, 0,25g, 1g. Offered by: TargetMol, Biosynth, Sigma-Aldrich.
| brand | TargetMol |
|---|---|
| catalog number | T21344-10mg |
| cas | 73285-50-4 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 10mg | 405.71 Pln | |
| TargetMol | 25mg | 545.46 Pln | |
| TargetMol | 50mg | 691.36 Pln | |
| TargetMol | 100mg | 944.03 Pln | |
| TargetMol | 200mg | 1288.93 Pln | |
| Biosynth | 0,5g | price on request | |
| Biosynth | 0,25g | price on request | |
| Biosynth | 1g | price on request | |
| Biosynth | 5g | price on request | |
| Biosynth | 2g | price on request | |
| Sigma-Aldrich | 10MG | 1540.00 Pln | |
| Sigma-Aldrich | 5MG | 1140.00 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
(2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 73285-50-4) is a chemical compound with the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. IUPAC name: (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: ZJIHMALTJRDNQI-VFQQELCFSA-N.
| Molecular formula | C6H14ClNO4 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | ZJIHMALTJRDNQI-VFQQELCFSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O.Cl |
Computed by PubChem (NCBI)