CAS 114976-76-0 appears in our catalog under these names: (2R,3S,4R)-2-((S)-1,2-Dihydroxyethyl)pyrrolidine-3,4-diol hydrochloride, 97%, 1,4-Dideoxy-1,4-imino-D-mannitol HCl, 1,4-Dideoxy-1,4-imino-D-mannitol hydroch, loride, 2 mg, 1,4-Dideoxy-1,4-imino-D-mannitol hydroch, loride, 5 mg, 1,4-Dideoxy-1,4-imino-D-mannitol hydroch, loride, 10 mg. Offered by: Chemat Brand, Biosynth, Roth. Available pack sizes: on request, 5mg, 2mg, 10mg, 25mg.
(2R,3S,4R)-2-[(1S)-1,2-dihydroxyethyl]pyrrolidine-3,4-diol;hydrochloride (CAS 114976-76-0) is a chemical compound with the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. IUPAC name: (2R,3S,4R)-2-[(1S)-1,2-dihydroxyethyl]pyrrolidine-3,4-diol;hydrochloride. InChIKey: IFRNNJQXHHLGKS-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO4 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R,3S,4R)-2-[(1S)-1,2-dihydroxyethyl]pyrrolidine-3,4-diol;hydrochloride |
| InChIKey | IFRNNJQXHHLGKS-MVNLRXSJSA-N |
| SMILES | C1[C@H]([C@H]([C@H](N1)[C@@H](CO)O)O)O.Cl |
Computed by PubChem (NCBI)