CAS 210223-32-8 is the registry number for 1-Deoxy-L-idonojirimycin Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg.
(2S,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 210223-32-8) is a chemical compound with the molecular formula C6H14ClNO4 and a molecular weight of 199.63 g/mol. IUPAC name: (2S,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: ZJIHMALTJRDNQI-SIQASLMSSA-N.
| Molecular formula | C6H14ClNO4 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2S,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | ZJIHMALTJRDNQI-SIQASLMSSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@@H](N1)CO)O)O)O.Cl |
Computed by PubChem (NCBI)