cas: 1089282-52-9 — see every product listed under this CAS number, including other names
1-Ethyl-2-fluoro-4-methoxy-5-nitrobenzene, 98%, 98% (CAS 1089282-52-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TAS-25g |
| cas | 1089282-52-9 |
| size | 25g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 11214.80 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 1024.40 Pln | |
| Chemat | 5g | 3222.80 Pln | |
| Chemat | 10g | 5334.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-ethyl-2-fluoro-4-methoxy-5-nitrobenzene (CAS 1089282-52-9) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: 1-ethyl-2-fluoro-4-methoxy-5-nitrobenzene. InChIKey: PKSQQMMVEVQWDK-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 1-ethyl-2-fluoro-4-methoxy-5-nitrobenzene |
| InChIKey | PKSQQMMVEVQWDK-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1F)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)