CAS 299166-66-8 appears in our catalog under these names: 2-Amino-2-(3-fluoro-4-methoxyphenyl)acetic acid, 95%, 2-(3-Fluoro-4-methoxyphenyl)-DL-glycine, 97+%, 2-Amino-2-(3-fluoro-4-methoxyphenyl)acetic acid, ≥97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
2-amino-2-(3-fluoro-4-methoxyphenyl)acetic acid (CAS 299166-66-8) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: 2-amino-2-(3-fluoro-4-methoxyphenyl)acetic acid. InChIKey: BPKLMQYFJHGPQW-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 2-amino-2-(3-fluoro-4-methoxyphenyl)acetic acid |
| InChIKey | BPKLMQYFJHGPQW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(=O)O)N)F |
Computed by PubChem (NCBI)