CAS 28987-50-0 is the registry number for 2-Fluoro-4-isopropoxy-1-nitrobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
2-fluoro-1-nitro-4-propan-2-yloxybenzene (CAS 28987-50-0) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: 2-fluoro-1-nitro-4-propan-2-yloxybenzene. InChIKey: REPLNSXVODYQGI-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 2-fluoro-1-nitro-4-propan-2-yloxybenzene |
| InChIKey | REPLNSXVODYQGI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)