cas: 874291-00-6 — see every product listed under this CAS number, including other names
1-Ethyl-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea 98% (CAS 874291-00-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A127934-250mg |
| cas | 874291-00-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A127934 |
1-ethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874291-00-6) is a chemical compound with the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. IUPAC name: 1-ethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: BYHDTZHNPIWVOP-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O3 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 1-ethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | BYHDTZHNPIWVOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NCC |
Computed by PubChem (NCBI)