Products 960067-55-4
CAS 960067-55-4 is the registry number for 2-Amino-n,n-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-amino-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 960067-55-4) is a chemical compound with the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. IUPAC name: 2-amino-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: FWWIAZQVLGDZIO-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O3 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 2-amino-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | FWWIAZQVLGDZIO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)C(=O)N(C)C |
Computed by PubChem (NCBI)