CAS 897935-17-0 is the registry number for 5-Morpholinopyridine-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]morpholine (CAS 897935-17-0) is a chemical compound with the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. IUPAC name: 4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]morpholine. InChIKey: XXNGNDDZPWTJOE-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O3 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]morpholine |
| InChIKey | XXNGNDDZPWTJOE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=C(C=C2)N3CCOCC3 |
Computed by PubChem (NCBI)