1-Ethyl-3-methylimidazolium Nitrate, 99%
cas: 143314-14-1 — see every product listed under this CAS number, including other names
1-Ethyl-3-methylimidazolium Nitrate, 99% (CAS 143314-14-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch117VCI-1g |
| cas | 143314-14-1 |
| size | 1g |
| availability | 300g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 15g | 323.60 Pln | |
| Chemat | 25g | 395.60 Pln | |
| Chemat | 100g | 1394.00 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 25g | 716.43 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-ethyl-3-methylimidazol-3-ium nitrate (CAS 143314-14-1) is a chemical compound with the molecular formula C6H11N3O3 and a molecular weight of 173.17 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium nitrate. InChIKey: JDOJFSVGXRJFLL-UHFFFAOYSA-N.
| Molecular formula | C6H11N3O3 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium nitrate |
| InChIKey | JDOJFSVGXRJFLL-UHFFFAOYSA-N |
| SMILES | CCN1C=C[N+](=C1)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-Ethyl-3-methylimidazolium nitrate, 1-ethyl-3-methyl-1H-imidazol-3-ium nitrate, 1-ethyl-3-methylimidazol-3-ium;nitrate, EMImNO3, 3-Ethyl-1-methyl-1H-imidazol-3-ium Nitrate, [emim]no3, JDOJFSVGXRJFLL-UHFFFAOYSA-N, Tox21_202798, 1-Ethyl-3-methyl-3-imidazolium Nitrate, 1-ethyl-3-methyl-imidazol-3-ium;nitrate