Products 1201935-53-6
CAS 1201935-53-6 is the registry number for tert-Butyl 3-(4-nitro-1H-pyrazol-1-yl)piperidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(4-nitropyrazol-1-yl)piperidine-1-carboxylate (CAS 1201935-53-6) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: tert-butyl 3-(4-nitropyrazol-1-yl)piperidine-1-carboxylate. InChIKey: XROLHUVPFAYLKY-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | tert-butyl 3-(4-nitropyrazol-1-yl)piperidine-1-carboxylate |
| InChIKey | XROLHUVPFAYLKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)N2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)