Products 84321-40-4
CAS 84321-40-4 appears in our catalog under these names: Pentoxifylline Impurity 13, Pentoxifylline Impurity 9, 1-Methyl-4-(1-methyl-3-(5-oxohexyl)ureido)-1H-imidazole-5-carboxylic acid, 98%, Pentoxifylline Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-methyl-5-[methyl(5-oxohexylcarbamoyl)amino]imidazole-4-carboxylic acid (CAS 84321-40-4) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: 3-methyl-5-[methyl(5-oxohexylcarbamoyl)amino]imidazole-4-carboxylic acid. InChIKey: VBOSZPMTSNGBNM-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 3-methyl-5-[methyl(5-oxohexylcarbamoyl)amino]imidazole-4-carboxylic acid |
| InChIKey | VBOSZPMTSNGBNM-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCCNC(=O)N(C)C1=C(N(C=N1)C)C(=O)O |
Computed by PubChem (NCBI)