1-Ethynyl-4-phenoxybenzene 97%
cas: 4200-06-0 — see every product listed under this CAS number, including other names
1-Ethynyl-4-phenoxybenzene 97% (CAS 4200-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A459036-100mg |
| cas | 4200-06-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1293.75 Pln | |
| Ambeed | 10g | 2033.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A459036 |
1-ethynyl-4-phenoxybenzene (CAS 4200-06-0) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 1-ethynyl-4-phenoxybenzene. InChIKey: LKMNQDOAPYPSNH-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-ethynyl-4-phenoxybenzene |
| InChIKey | LKMNQDOAPYPSNH-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)