CAS 399-25-7 appears in our catalog under these names: 1-Fluoro-2-(2-nitrovinyl)benzene, 98%, 98%, 2-Fluoro-ß-nitrostyrene, 98%, 1-Fluoro-2-(2-nitrovinyl)benzene, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
1-fluoro-2-[(E)-2-nitroethenyl]benzene (CAS 399-25-7) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 1-fluoro-2-[(E)-2-nitroethenyl]benzene. InChIKey: NKZSNHAEWKEFNE-AATRIKPKSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 1-fluoro-2-[(E)-2-nitroethenyl]benzene |
| InChIKey | NKZSNHAEWKEFNE-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/[N+](=O)[O-])F |
Computed by PubChem (NCBI)