CAS 398-63-0 appears in our catalog under these names: 6-Fluoro-2,4-dihydro-1,4-benzoxazin-3-one, 97%, 6-FLUORO-2H-BENZO[B][1,4]OXAZIN-3[4H]-ONE, 97%, 97%, 6-Fluoro-2H-1,4-benzoxazin-3(4H)-one, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
6-fluoro-4H-1,4-benzoxazin-3-one (CAS 398-63-0) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 6-fluoro-4H-1,4-benzoxazin-3-one. InChIKey: ZKNRUFWEZPGGQP-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 6-fluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | ZKNRUFWEZPGGQP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)F |
Computed by PubChem (NCBI)