CAS 103361-99-5 appears in our catalog under these names: 7-Fluoro-2H-1,4-benzoxazin-3(4H)-one, 98%, 7–Fluoro–2H–1,4–benzoxazin–3(4H)–one, 7-Fluoro-2H-1,4-benzoxazin-3(4H)-one, 98%, 98%, 7-Fluoro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
7-fluoro-4H-1,4-benzoxazin-3-one (CAS 103361-99-5) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: 7-fluoro-4H-1,4-benzoxazin-3-one. InChIKey: TXRXHEOGQVPEBT-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | 7-fluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | TXRXHEOGQVPEBT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)F |
Computed by PubChem (NCBI)