cas: 124170-06-5 — see every product listed under this CAS number, including other names
1-Fluoro-2-nitro-4-(trifluoromethoxy)benzene, 98% (CAS 124170-06-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329588-1G |
| cas | 124170-06-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 25g | 1513.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-fluoro-2-nitro-4-(trifluoromethoxy)benzene (CAS 124170-06-5) is a chemical compound with the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. IUPAC name: 1-fluoro-2-nitro-4-(trifluoromethoxy)benzene. InChIKey: XWFNBCCMBGKMFB-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO3 |
|---|---|
| Molecular weight | 225.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-(trifluoromethoxy)benzene |
| InChIKey | XWFNBCCMBGKMFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)