CAS 1365272-87-2 is the registry number for 2-Fluoro-1-nitro-3-(trifluoromethoxy)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-fluoro-1-nitro-3-(trifluoromethoxy)benzene (CAS 1365272-87-2) is a chemical compound with the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. IUPAC name: 2-fluoro-1-nitro-3-(trifluoromethoxy)benzene. InChIKey: VUOGBZMYTZNXTC-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO3 |
|---|---|
| Molecular weight | 225.10 g/mol |
| IUPAC name | 2-fluoro-1-nitro-3-(trifluoromethoxy)benzene |
| InChIKey | VUOGBZMYTZNXTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)