Products 206546-18-1
CAS 206546-18-1 appears in our catalog under these names: 3-(Difluoromethoxy)-1,2-difluoro-4-nitro-benzene, 95%, 3,4-Difluoro-2-(difluoromethoxy)nitrobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g.
3-(difluoromethoxy)-1,2-difluoro-4-nitrobenzene (CAS 206546-18-1) is a chemical compound with the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. IUPAC name: 3-(difluoromethoxy)-1,2-difluoro-4-nitrobenzene. InChIKey: LUDLBDDNEVIJJC-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO3 |
|---|---|
| Molecular weight | 225.10 g/mol |
| IUPAC name | 3-(difluoromethoxy)-1,2-difluoro-4-nitrobenzene |
| InChIKey | LUDLBDDNEVIJJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])OC(F)F)F)F |
Computed by PubChem (NCBI)