cas: 6526-72-3 — see every product listed under this CAS number, including other names
1-Isopropyl-2-nitrobenzene (CAS 6526-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241909-100MG |
| cas | 6526-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 25g | 1674.43 Pln |
| delivery time | 3-4 weeks |
|---|
1-nitro-2-propan-2-ylbenzene (CAS 6526-72-3) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1-nitro-2-propan-2-ylbenzene. InChIKey: BSMKYQUHXQAVKG-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1-nitro-2-propan-2-ylbenzene |
| InChIKey | BSMKYQUHXQAVKG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)